| Product Name | 8-Chloroquinaldine |
| CAS No. | 3033-82-7 |
| Synonyms | 8-Chloro-2-methylquinoline; 2-Methyl-8-chloroquinoline |
| InChI | InChI=1/C10H8ClN/c1-7-5-6-8-3-2-4-9(11)10(8)12-7/h2-6H,1H3 |
| Molecular Formula | C10H8ClN |
| Molecular Weight | 177.6302 |
| Density | 1.225g/cm3 |
| Melting point | 64-66℃ |
| Boiling point | 278.2°C at 760 mmHg |
| Flash point | 148.7°C |
| Refractive index | 1.634 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
3033-82-7 8-chloroquinaldine
service@apichina.com