| Product Name | 8-Carboxynaphthalene-1-carboxamide |
| CAS No. | 5811-88-1 |
| Synonyms | 8-Carbamoylnaphthalene-1-carboxylic acid~1,8-Naphthalic acid monoamide; 8-carbamoylnaphthalene-1-carboxylic acid |
| InChI | InChI=1/C12H9NO3/c13-11(14)8-5-1-3-7-4-2-6-9(10(7)8)12(15)16/h1-6H,(H2,13,14)(H,15,16) |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.2048 |
| Density | 1.39g/cm3 |
| Boiling point | 544.7°C at 760 mmHg |
| Flash point | 283.2°C |
| Refractive index | 1.702 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
5811-88-1 8-carboxynaphthalene-1-carboxamide
service@apichina.com