| Product Name | (8-bromo-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)(phenyl)methanone |
| CAS No. | 175136-38-6 |
| InChI | InChI=1/C16H13BrO3/c17-13-10-15-14(19-7-4-8-20-15)9-12(13)16(18)11-5-2-1-3-6-11/h1-3,5-6,9-10H,4,7-8H2 |
| Molecular Formula | C16H13BrO3 |
| Molecular Weight | 333.1766 |
| Density | 1.446g/cm3 |
| Melting point | 105℃ |
| Boiling point | 448°C at 760 mmHg |
| Flash point | 224.8°C |
| Refractive index | 1.602 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175136-38-6 (8-bromo-3,4-dihydro-2h-1,5-benzodioxepin-7-yl)(phenyl)methanone
service@apichina.com