| Product Name | 8,9-difluoro-5-methyl-1,7-dioxo-6,7-dihydro-1H,5H-pyrido[3,2,1-ij]quinoline-2-carboxylic acid |
| CAS No. | 306935-69-3 |
| Synonyms | 8,9-Difluoro-5-methyl-1,7-dioxo-6,7-dihydro-1H,5H-pyrido[3,2,1-ij]quinoline-2-carbox |
| InChI | InChI=1/C14H9F2NO4/c1-5-2-9(18)10-11(16)8(15)3-6-12(10)17(5)4-7(13(6)19)14(20)21/h3-5H,2H2,1H3,(H,20,21) |
| Molecular Formula | C14H9F2NO4 |
| Molecular Weight | 293.2224 |
| Density | 1.61g/cm3 |
| Melting point | 323℃ |
| Boiling point | 532.1°C at 760 mmHg |
| Flash point | 275.6°C |
| Refractive index | 1.641 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
306935-69-3 8,9-difluoro-5-methyl-1,7-dioxo-6,7-dihydro-1h,5h-pyrido[3,2,1-ij]quinoline-2-carboxylic
service@apichina.com