| Product Name | 7-Phenylheptanoic acid |
| CAS No. | 40228-90-8 |
| InChI | InChI=1/C13H18O2/c14-13(15)11-7-2-1-4-8-12-9-5-3-6-10-12/h3,5-6,9-10H,1-2,4,7-8,11H2,(H,14,15) |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.2808 |
| Density | 1.034g/cm3 |
| Boiling point | 356.5°C at 760 mmHg |
| Flash point | 253.5°C |
| Refractive index | 1.519 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
40228-90-8 7-phenylheptanoic acid
service@apichina.com