| Product Name | 7-iodo-9H-fluorene-4-carboxylic acid |
| CAS No. | 16218-33-0 |
| InChI | InChI=1/C14H9IO2/c15-10-4-5-11-9(7-10)6-8-2-1-3-12(13(8)11)14(16)17/h1-5,7H,6H2,(H,16,17) |
| Molecular Formula | C14H9IO2 |
| Molecular Weight | 336.1245 |
| Density | 1.837g/cm3 |
| Melting point | 265℃ |
| Boiling point | 502°C at 760 mmHg |
| Flash point | 257.4°C |
| Refractive index | 1.738 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
16218-33-0 7-iodo-9h-fluorene-4-carboxylic acid
service@apichina.com