| Product Name | 7-Hydroxyflavanone |
| CAS No. | 6515-36-2 |
| Synonyms | 4H-1-Benzopyran-4-one, 2,3-dihydro-7-hydroxy-2-phenyl-; 7-hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one; (2R)-7-hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one; (2S)-7-hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one |
| InChI | InChI=1/C15H12O3/c16-11-6-7-12-13(17)9-14(18-15(12)8-11)10-4-2-1-3-5-10/h1-8,14,16H,9H2/t14-/m0/s1 |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.254 |
| Density | 1.288g/cm3 |
| Melting point | 188-190℃ |
| Boiling point | 464.3°C at 760 mmHg |
| Flash point | 181.2°C |
| Refractive index | 1.631 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6515-36-2 7-hydroxyflavanone
service@apichina.com