| Product Name | 7-Hydroxy-4-methyl-8-nitrocoumarin |
| CAS No. | 19037-69-5 |
| Synonyms | 4-Methyl-8-nitroumbelliferone; 7-hydroxy-4-methyl-8-nitro-2H-chromen-2-one |
| InChI | InChI=1/C10H7NO5/c1-5-4-8(13)16-10-6(5)2-3-7(12)9(10)11(14)15/h2-4,12H,1H3 |
| Molecular Formula | C10H7NO5 |
| Molecular Weight | 221.1663 |
| Density | 1.521g/cm3 |
| Boiling point | 402.5°C at 760 mmHg |
| Flash point | 197.2°C |
| Refractive index | 1.648 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
19037-69-5 7-hydroxy-4-methyl-8-nitrocoumarin
service@apichina.com