| Product Name | {7-chloro-1-methyl-9-[(4-methylpiperazin-1-yl)methyl]-9H-thioxanthen-2-yl}methanol di[(2E)-but-2-enedioate] (salt) |
| CAS No. | 66949-71-1 |
| InChI | InChI=1/C21H25ClN2OS.2C4H4O4/c1-14-15(13-25)3-5-20-21(14)18(12-24-9-7-23(2)8-10-24)17-11-16(22)4-6-19(17)26-20;2*5-3(6)1-2-4(7)8/h3-6,11,18,25H,7-10,12-13H2,1-2H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| Molecular Formula | C29H33ClN2O9S |
| Molecular Weight | 621.0983 |
| Boiling point | 531.1°C at 760 mmHg |
| Flash point | 275°C |
66949-71-1 {7-chloro-1-methyl-9-[(4-methylpiperazin-1-yl)methyl]-9h-thioxanthen-2-yl}methanol di[(2e
service@apichina.com