| Product Name | 7-Bromo-4H-1,3-benzodioxine |
| CAS No. | 499770-95-5 |
| InChI | InChI=1/C8H7BrO2/c9-7-2-1-6-4-10-5-11-8(6)3-7/h1-3H,4-5H2 |
| Molecular Formula | C8H7BrO2 |
| Molecular Weight | 215.044 |
| Density | 1.598g/cm3 |
| Melting point | 55.5℃ |
| Boiling point | 284.9°C at 760 mmHg |
| Flash point | 137.1°C |
| Refractive index | 1.579 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
499770-95-5 7-bromo-4h-1,3-benzodioxine
service@apichina.com