| Sales Email | Service@apichina.com |
| CAS No. | 154264-95-6 |
| Product Name | 7-bromo-4-methyl-3,4-dihydro-2H-1,4-benzoxazine |
| Synonyms | 7-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine |
| InChI | InChI=1/C9H10BrNO/c1-11-4-5-12-9-6-7(10)2-3-8(9)11/h2-3,6H,4-5H2,1H3 |
| Molecular Formula | C9H10BrNO |
| Molecular Weight | 228.0858 |
| Density | 1.476g/cm3 |
| Boiling point | 309.187°C at 760 mmHg |
| Flash point | 140.792°C |
| Refractive index | 1.579 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
