| Product Name | 7-Bromo-1-hydroxyisoquinoline |
| CAS No. | 223671-15-6 |
| Synonyms | 7-Bromoisocarbostyril; 7-bromoisoquinolin-1(2H)-one; 7-bromo-1(2H)-isoquinolone |
| InChI | InChI=1/C9H6BrNO/c10-7-2-1-6-3-4-11-9(12)8(6)5-7/h1-5H,(H,11,12) |
| Molecular Formula | C9H6BrNO |
| Molecular Weight | 224.054 |
| Density | 1.62g/cm3 |
| Boiling point | 427.5°C at 760 mmHg |
| Flash point | 212.4°C |
| Refractive index | 1.63 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
223671-15-6 7-bromo-1-hydroxyisoquinoline
service@apichina.com