| Product Name | 7-Benzoylheptanoic acid |
| CAS No. | 66147-75-9 |
| Synonyms | 8-Oxo-8-phenyloctanoic acid |
| InChI | InChI=1/C14H18O3/c15-13(12-8-4-3-5-9-12)10-6-1-2-7-11-14(16)17/h3-5,8-9H,1-2,6-7,10-11H2,(H,16,17) |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.2909 |
| Density | 1.091g/cm3 |
| Boiling point | 407.1°C at 760 mmHg |
| Flash point | 214.2°C |
| Refractive index | 1.523 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
66147-75-9 7-benzoylheptanoic acid
service@apichina.com