| Product Name | 7-Amino-5-bromoindole |
| CAS No. | 374537-99-2 |
| Synonyms | 5-Bromo-7-indolamine; 5-bromo-1H-indol-7-amine |
| InChI | InChI=1/C8H7BrN2/c9-6-3-5-1-2-11-8(5)7(10)4-6/h1-4,11H,10H2 |
| Molecular Formula | C8H7BrN2 |
| Molecular Weight | 211.0586 |
| Density | 1.753g/cm3 |
| Boiling point | 405.6°C at 760 mmHg |
| Flash point | 199.1°C |
| Refractive index | 1.779 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
374537-99-2 7-amino-5-bromoindole
service@apichina.com