| Product Name | 7,8-Dihydroxy-4-methylcoumarin |
| CAS No. | 2107-77-9 |
| Synonyms | 4-Methyldaphnetin; 7,8-dihydroxy-4-methyl-2H-chromen-2-one |
| InChI | InChI=1/C10H8O4/c1-5-4-8(12)14-10-6(5)2-3-7(11)9(10)13/h2-4,11,13H,1H3 |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.1681 |
| Density | 1.456g/cm3 |
| Boiling point | 421.5°C at 760 mmHg |
| Flash point | 176°C |
| Refractive index | 1.651 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2107-77-9 7,8-dihydroxy-4-methylcoumarin
service@apichina.com