| Product Name | 7,7-Dichlorobicyclo(3.2.0)hept-2-en-6-one |
| CAS No. | 5307-99-3 |
| Synonyms | Dichlorobicycloheptenone; 7,7-Dichlorobicyclo[3.2.0]hept-2-en-6-one; (1R,5R)-7,7-dichlorobicyclo[3.2.0]hept-2-en-6-one; (1S,5S)-7,7-dichlorobicyclo[3.2.0]hept-2-en-6-one; (1R,5S)-7,7-dichlorobicyclo[3.2.0]hept-2-en-6-one; (1S,5R)-7,7-dichlorobicyclo[3.2.0]hept-2-en-6-one |
| InChI | InChI=1/C7H6Cl2O/c8-7(9)5-3-1-2-4(5)6(7)10/h1,3-5H,2H2/t4-,5+/m1/s1 |
| Molecular Formula | C7H6Cl2O |
| Molecular Weight | 177.0279 |
| Density | 1.44g/cm3 |
| Boiling point | 274.8°C at 760 mmHg |
| Flash point | 114.1°C |
| Refractive index | 1.568 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
5307-99-3 7,7-dichlorobicyclo(3.2.0)hept-2-en-6-one
service@apichina.com