| Product Name | 6-quinoxalinecarbonyl chloride |
| CAS No. | 258503-93-4 |
| Synonyms | quinoxaline-6-carbonyl chloride |
| InChI | InChI=1/C9H5ClN2O/c10-9(13)6-1-2-7-8(5-6)12-4-3-11-7/h1-5H |
| Molecular Formula | C9H5ClN2O |
| Molecular Weight | 192.6018 |
| Density | 1.411g/cm3 |
| Boiling point | 324.4°C at 760 mmHg |
| Flash point | 150°C |
| Refractive index | 1.662 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
258503-93-4 6-quinoxalinecarbonyl chloride
service@apichina.com