| Product Name | 6-phenoxynicotinoyl chloride |
| CAS No. | 51362-51-7 |
| Synonyms | 6-phenoxypyridine-3-carbonyl chloride |
| InChI | InChI=1/C12H8ClNO2/c13-12(15)9-6-7-11(14-8-9)16-10-4-2-1-3-5-10/h1-8H |
| Molecular Formula | C12H8ClNO2 |
| Molecular Weight | 233.6504 |
| Density | 1.3g/cm3 |
| Melting point | 81℃ |
| Boiling point | 354.3°C at 760 mmHg |
| Flash point | 168.1°C |
| Refractive index | 1.594 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
51362-51-7 6-phenoxynicotinoyl chloride
service@apichina.com