| Product Name | 6-phenoxynicotinic acid |
| CAS No. | 51362-38-0 |
| Synonyms | 6-phenoxypyridine-3-carboxylic acid |
| InChI | InChI=1/C12H9NO3/c14-12(15)9-6-7-11(13-8-9)16-10-4-2-1-3-5-10/h1-8H,(H,14,15) |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.2048 |
| Density | 1.298g/cm3 |
| Melting point | 164℃ |
| Boiling point | 391.2°C at 760 mmHg |
| Flash point | 190.4°C |
| Refractive index | 1.613 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
51362-38-0 6-phenoxynicotinic acid
service@apichina.com