| Product Name | 6-phenoxy-3-pyridinyl isothiocyanate |
| CAS No. | 52024-70-1 |
| Synonyms | 5-isothiocyanato-2-phenoxypyridine |
| InChI | InChI=1/C12H8N2OS/c16-9-14-10-6-7-12(13-8-10)15-11-4-2-1-3-5-11/h1-8H |
| Molecular Formula | C12H8N2OS |
| Molecular Weight | 228.2697 |
| Density | 1.18g/cm3 |
| Melting point | 40℃ |
| Boiling point | 374.9°C at 760 mmHg |
| Flash point | 180.5°C |
| Refractive index | 1.615 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
52024-70-1 6-phenoxy-3-pyridinyl isothiocyanate
service@apichina.com