| Product Name | 6-phenoxy-3-pyridinamine |
| CAS No. | 25194-67-6 |
| Synonyms | Pyridine, 5-amino-2-phenoxy-; 3-Amino-6-phenoxypyridine; 4-22-00-05575 (Beilstein Handbook Reference); 5-Amino-2-phenoxypyridine; BRN 0140834; 6-phenoxypyridin-3-amine |
| InChI | InChI=1/C11H10N2O/c12-9-6-7-11(13-8-9)14-10-4-2-1-3-5-10/h1-8H,12H2 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.2099 |
| Density | 1.197g/cm3 |
| Boiling point | 365.3°C at 760 mmHg |
| Flash point | 174.7°C |
| Refractive index | 1.625 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
25194-67-6 6-phenoxy-3-pyridinamine
service@apichina.com