| Product Name | 6-nitroveratryl chloroformate |
| CAS No. | 42855-00-5 |
| Synonyms | 4,5-dimethoxy-2-nitrobenzyl chloroformate; Chloroformic acid 6-nitroveratryl ester~4,5-Dimethoxy-2-nitrobenzyl chloroformate~NVOC-Cl; 4,5-dimethoxy-2-nitrobenzyl chlorocarbonate |
| InChI | InChI=1/C10H10ClNO6/c1-16-8-3-6(5-18-10(11)13)7(12(14)15)4-9(8)17-2/h3-4H,5H2,1-2H3 |
| Molecular Formula | C10H10ClNO6 |
| Molecular Weight | 275.6425 |
| Density | 1.399g/cm3 |
| Melting point | 125℃ |
| Boiling point | 396.4°C at 760 mmHg |
| Flash point | 193.5°C |
| Refractive index | 1.545 |
| Risk Codes | R34:Causes burns.; R37:Irritating to respiratory system.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
42855-00-5 6-nitroveratryl chloroformate
service@apichina.com