| Product Name | 6-morpholinonicotinoyl chloride |
| CAS No. | 313350-36-6 |
| Synonyms | 6-morpholin-4-ylpyridine-3-carbonyl chloride |
| InChI | InChI=1/C10H11ClN2O2/c11-10(14)8-1-2-9(12-7-8)13-3-5-15-6-4-13/h1-2,7H,3-6H2 |
| Molecular Formula | C10H11ClN2O2 |
| Molecular Weight | 226.6595 |
| Density | 1.314g/cm3 |
| Melting point | 122℃ |
| Boiling point | 400.9°C at 760 mmHg |
| Flash point | 196.3°C |
| Refractive index | 1.568 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
313350-36-6 6-morpholinonicotinoyl chloride
service@apichina.com