| Product Name | 6-morpholinonicotinic acid |
| CAS No. | 120800-52-4 |
| Synonyms | 6-morpholinopyridine-3-carboxylic acid |
| InChI | InChI=1/C10H12N2O3/c13-10(14)8-1-2-9(11-7-8)12-3-5-15-6-4-12/h1-2,7H,3-6H2,(H,13,14) |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.2139 |
| Density | 1.314g/cm3 |
| Melting point | 261℃ |
| Boiling point | 446.074°C at 760 mmHg |
| Flash point | 223.578°C |
| Refractive index | 1.585 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
120800-52-4 6-morpholinonicotinic acid
service@apichina.com