| Product Name | 6-morpholinonicotinaldehyde |
| CAS No. | 173282-60-5 |
| Synonyms | 6-Morpholin-4-yl-pyridine-3-carbaldehyde |
| InChI | InChI=1/C10H12N2O2/c13-8-9-1-2-10(11-7-9)12-3-5-14-6-4-12/h1-2,7-8H,3-6H2 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.2145 |
| Density | 1.219g/cm3 |
| Melting point | 84℃ |
| Boiling point | 395.8°C at 760 mmHg |
| Flash point | 193.2°C |
| Refractive index | 1.586 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
173282-60-5 6-morpholinonicotinaldehyde
service@apichina.com