| Product Name | 6-morpholino-3-pyridinyl isothiocyanate |
| CAS No. | 52024-29-0 |
| Synonyms | 4-(5-isothiocyanatopyridin-2-yl)morpholine; 4-(5-isothiocyanato-2-pyridyl)morpholine |
| InChI | InChI=1/C10H11N3OS/c15-8-12-9-1-2-10(11-7-9)13-3-5-14-6-4-13/h1-2,7H,3-6H2 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.2788 |
| Density | 1.287g/cm3 |
| Boiling point | 422.631°C at 760 mmHg |
| Flash point | 209.4°C |
| Refractive index | 1.645 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
52024-29-0 6-morpholino-3-pyridinyl isothiocyanate
service@apichina.com