| Product Name | 6-Methylpyridazin-3-amine |
| CAS No. | 18591-82-7 |
| Synonyms | 3-Amino-6-Methylpyridazine |
| InChI | InChI=1/C4H4IN3/c5-3-1-2-4(6)8-7-3/h1-2H,(H2,6,8) |
| Molecular Formula | C5H7N3 |
| Molecular Weight | 109.13068 |
| Density | 2.204g/cm3 |
| Melting point | 230℃ |
| Boiling point | 399.6°C at 760 mmHg |
| Flash point | 195.5°C |
| Refractive index | 1.719 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
18591-82-7 6-methylpyridazin-3-amine
service@apichina.com