| Product Name | 6-Methylpyridazin-3(2H)-one |
| CAS No. | 13327-27-0 |
| Synonyms | 6-Methyl-3(2H)-pyridazinone; 6-Methylpyridazin-3-one; ; 6-methylpyridazin-3-ol; 6-Methyl-2H-pyridazin-3-one |
| InChI | InChI=1/C5H6N2O/c1-4-2-3-5(8)7-6-4/h2-3H,1H3,(H,7,8) |
| Molecular Formula | C5H6N2O |
| Molecular Weight | 110.1139 |
| Density | 1.22g/cm3 |
| Boiling point | 310.3°C at 760 mmHg |
| Flash point | 141.5°C |
| Refractive index | 1.576 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
13327-27-0 6-methylpyridazin-3(2h)-one
service@apichina.com