| Product Name | 6-Methylindole-3-caboxaldehyde |
| CAS No. | 4771-49-7 |
| Synonyms | 6-Methylindole-3-carboxaldehyde; 3-Formyl-6-methylindole; 6-methyl-1H-indole-3-carbaldehyde |
| InChI | InChI=1/C10H9NO/c1-7-2-3-9-8(6-12)5-11-10(9)4-7/h2-6,11H,1H3 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.1846 |
| Density | 1.226g/cm3 |
| Boiling point | 339.3°C at 760 mmHg |
| Flash point | 167°C |
| Refractive index | 1.698 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4771-49-7 6-methylindole-3-caboxaldehyde
service@apichina.com