| Product Name | 6-Methyl-5-nitroquinoline |
| CAS No. | 23141-61-9 |
| Synonyms | NSC 162892; 6-methyl-5-nitro-isoquinoline |
| InChI | InChI=1/C10H8N2O2/c1-7-2-3-8-6-11-5-4-9(8)10(7)12(13)14/h2-6H,1H3 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.18 |
| Density | 1.298g/cm3 |
| Melting point | 117℃ |
| Boiling point | 342.4°C at 760 mmHg |
| Flash point | 160.9°C |
| Refractive index | 1.661 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; R40:Possible risks of irreversible effects.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
23141-61-9 6-methyl-5-nitroquinoline
service@apichina.com