| Product Name | 6-Methyl-1,2,3,4-tetrahydroquinoline |
| CAS No. | 91-61-2 |
| Synonyms | 1,2,3,4-Tetrahydro-6-methylquinoline; AI3-36188; Civettal; NSC 65606; p-Methyltetrahydroquinoline; Quinoline, 1,2,3,4-tetrahydro-6-methyl- |
| InChI | InChI=1/C10H13N/c1-8-4-5-10-9(7-8)3-2-6-11-10/h4-5,7,11H,2-3,6H2,1H3 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.2169 |
| Density | 0.99g/cm3 |
| Boiling point | 264.2°C at 760 mmHg |
| Flash point | 119.1°C |
| Refractive index | 1.539 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
91-61-2 6-methyl-1,2,3,4-tetrahydroquinoline
service@apichina.com