| Product Name | 6-Methoxysalicylaldehyde |
| CAS No. | 700-44-7 |
| Synonyms | 2-Hydroxy-6-methoxybenzaldehyde; 6-Hydroxy-o-anisaldehyde; 2-hydroxy-6-methoxy benzaldehyde |
| InChI | InChI=1/C8H8O3/c1-11-8-4-2-3-7(10)6(8)5-9/h2-5,10H,1H3 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.1473 |
| Density | 1.231g/cm3 |
| Boiling point | 262.9°C at 760 mmHg |
| Flash point | 107.8°C |
| Refractive index | 1.587 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
700-44-7 6-methoxysalicylaldehyde
service@apichina.com