| Product Name | 6-methoxypyridine-3-carbothioamide |
| CAS No. | 175277-49-3 |
| Synonyms | 6-methoxy-3-Pyridinecarbothioamide |
| InChI | InChI=1/C7H8N2OS/c1-10-6-3-2-5(4-9-6)7(8)11/h2-4H,1H3,(H2,8,11) |
| Molecular Formula | C7H8N2OS |
| Molecular Weight | 168.2162 |
| Density | 1.262g/cm3 |
| Melting point | 150℃ |
| Boiling point | 292.5°C at 760 mmHg |
| Flash point | 130.7°C |
| Refractive index | 1.626 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175277-49-3 6-methoxypyridine-3-carbothioamide
service@apichina.com