| Product Name | 6-methoxyflavanone |
| CAS No. | 3034-04-6 |
| Synonyms | 6-Methoxyflavanone; 2,3-Dihydro-6-methoxy-2-phenyl-4H-1-benzopyran-4-one; NSC 50184; 4H-1-Benzopyran-4-one, 2,3-dihydro-6-methoxy-2-phenyl-; 6-methoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one; (2S)-6-methoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one; (2R)-6-methoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one |
| InChI | InChI=1/C16H14O3/c1-18-12-7-8-15-13(9-12)14(17)10-16(19-15)11-5-3-2-4-6-11/h2-9,16H,10H2,1H3/t16-/m1/s1 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.2806 |
| Density | 1.199g/cm3 |
| Melting point | 141-143℃ |
| Boiling point | 425.5°C at 760 mmHg |
| Flash point | 202.9°C |
| Refractive index | 1.587 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
3034-04-6 6-methoxyflavanone
service@apichina.com