| Product Name | 6-methoxy-2-naphthoic acid |
| CAS No. | 2471-70-7 |
| Synonyms | 6-Methoxy-naphthalene-2-carboxylic acid; 6-methoxynaphthalene-2-carboxylate |
| InChI | InChI=1/C12H10O3/c1-15-11-5-4-8-6-10(12(13)14)3-2-9(8)7-11/h2-7H,1H3,(H,13,14)/p-1 |
| Molecular Formula | C12H9O3 |
| Molecular Weight | 201.1986 |
| Boiling point | 371.1°C at 760 mmHg |
| Flash point | 147.8°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2471-70-7 6-methoxy-2-naphthoic acid
service@apichina.com