| Product Name | 6-Hydroxyflavanone |
| CAS No. | 4250-77-5 |
| Synonyms | (2R)-6-hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one; (2S)-6-hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one; 6-hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one |
| InChI | InChI=1/C15H12O3/c16-11-6-7-14-12(8-11)13(17)9-15(18-14)10-4-2-1-3-5-10/h1-8,15-16H,9H2 |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.254 |
| Density | 1.288g/cm3 |
| Melting point | 220-222℃ |
| Boiling point | 464.3°C at 760 mmHg |
| Flash point | 181.2°C |
| Refractive index | 1.631 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4250-77-5 6-hydroxyflavanone
service@apichina.com