| Product Name | 6-Hydroxy-4-methylcoumarin |
| CAS No. | 2373-31-1 |
| Synonyms | 6-Hydroxy-4-methyl-2-benzopyrone; 6-hydroxy-4-methyl-2H-chromen-2-one |
| InChI | InChI=1/C10H8O3/c1-6-4-10(12)13-9-3-2-7(11)5-8(6)9/h2-5,11H,1H3 |
| Molecular Formula | C10H8O3 |
| Molecular Weight | 176.1687 |
| Density | 1.319g/cm3 |
| Boiling point | 391.4°C at 760 mmHg |
| Flash point | 181.8°C |
| Refractive index | 1.611 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2373-31-1 6-hydroxy-4-methylcoumarin
service@apichina.com