| Product Name | 6-hydroxy-4,7-dimethoxybenzofuran-5-yl methyl ketone |
| CAS No. | 484-51-5 |
| Synonyms | Khellinone; 5-Acetyl-6-hydroxy-4,7-dimethoxybenzo[b]furan; 1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)ethanone |
| InChI | InChI=1/C12H12O5/c1-6(13)8-9(14)12(16-3)11-7(4-5-17-11)10(8)15-2/h4-5,14H,1-3H3 |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.2207 |
| Density | 1.281g/cm3 |
| Boiling point | 366.3°C at 760 mmHg |
| Flash point | 175.3°C |
| Refractive index | 1.583 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
484-51-5 6-hydroxy-4,7-dimethoxybenzofuran-5-yl methyl ketone
service@apichina.com