| Product Name | 6-formyl-2-(methylsulfanyl)nicotinonitrile |
| CAS No. | 175277-27-7 |
| Synonyms | 6-formyl-2-(methylsulfanyl)pyridine-3-carbonitrile |
| InChI | InChI=1/C8H6N2OS/c1-12-8-6(4-9)2-3-7(5-11)10-8/h2-3,5H,1H3 |
| Molecular Formula | C8H6N2OS |
| Molecular Weight | 178.211 |
| Density | 1.3g/cm3 |
| Melting point | 137℃ |
| Boiling point | 339.9°C at 760 mmHg |
| Flash point | 159.4°C |
| Refractive index | 1.6 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
175277-27-7 6-formyl-2-(methylsulfanyl)nicotinonitrile
service@apichina.com