| Product Name | 6-fluoro-4H-1,3-benzodioxin-8-yl isocyanate |
| CAS No. | 321309-30-2 |
| Synonyms | 6-Fluoro-4H-1,3-benzodioxen-8-yl-isocyanate; 6-fluoro-8-isocyanato-4H-1,3-benzodioxine; 6-Fluoro-8-isocyanato-4H-benzo[1,3]dioxine |
| InChI | InChI=1/C9H6FNO3/c10-7-1-6-3-13-5-14-9(6)8(2-7)11-4-12/h1-2H,3,5H2 |
| Molecular Formula | C9H6FNO3 |
| Molecular Weight | 195.1472 |
| Density | 1.41g/cm3 |
| Melting point | 77℃ |
| Boiling point | 333.4°C at 760 mmHg |
| Flash point | 155.5°C |
| Refractive index | 1.571 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
321309-30-2 6-fluoro-4h-1,3-benzodioxin-8-yl isocyanate
service@apichina.com