| Product Name | 6-ethoxy-2-mercaptobenzothiazole |
| CAS No. | 120-53-6 |
| Synonyms | 6-Ethoxybenzothiazolethiol; 6-ethoxy-1,3-benzothiazole-2(3H)-thione; 6-Ethoxy-Benzothiazole-2-Thiol |
| InChI | InChI=1/C9H9NOS2/c1-2-11-6-3-4-7-8(5-6)13-9(12)10-7/h3-5H,2H2,1H3,(H,10,12) |
| Molecular Formula | C9H9NOS2 |
| Molecular Weight | 211.3039 |
| Density | 1.37g/cm3 |
| Melting point | 198-200℃ |
| Boiling point | 358.5°C at 760 mmHg |
| Flash point | 170.6°C |
| Refractive index | 1.698 |
| Risk Codes | R36/37:Irritating to eyes and respiratory system.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
120-53-6 6-ethoxy-2-mercaptobenzothiazole
service@apichina.com