| Product Name | 6-(dimethoxymethyl)-2-mercaptonicotinonitrile |
| CAS No. | 175277-23-3 |
| Synonyms | 6-(dimethoxymethyl)-2-thioxo-1,2-dihydropyridine-3-carbonitrile |
| InChI | InChI=1/C9H10N2O2S/c1-12-9(13-2)7-4-3-6(5-10)8(14)11-7/h3-4,9H,1-2H3,(H,11,14) |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.2529 |
| Density | 1.27g/cm3 |
| Melting point | 132℃ |
| Boiling point | 285.8°C at 760 mmHg |
| Flash point | 126.6°C |
| Refractive index | 1.582 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
175277-23-3 6-(dimethoxymethyl)-2-mercaptonicotinonitrile
service@apichina.com