| Product Name | 6-chloroimidazo[2,1-b][1,3]thiazole |
| CAS No. | 23576-81-0 |
| InChI | InChI=1/C5H3ClN2S/c6-4-3-8-1-2-9-5(8)7-4/h1-3H |
| Molecular Formula | C5H3ClN2S |
| Molecular Weight | 158.6087 |
| Density | 1.66g/cm3 |
| Melting point | 82℃ |
| Refractive index | 1.78 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
23576-81-0 6-chloroimidazo[2,1-b][1,3]thiazole
service@apichina.com