| Product Name | 6-Chlorohexanoyl chloride |
| CAS No. | 19347-73-0 |
| Synonyms | 6-Chlorocaproyl chloride |
| InChI | InChI=1/C6H10Cl2O/c7-5-3-1-2-4-6(8)9/h1-5H2 |
| Molecular Formula | C6H10Cl2O |
| Molecular Weight | 169.049 |
| Density | 1.146g/cm3 |
| Boiling point | 204.8°C at 760 mmHg |
| Flash point | 82.9°C |
| Refractive index | 1.449 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
19347-73-0 6-chlorohexanoyl chloride
service@apichina.com