| Product Name | 6-Chloro-m-anisidine |
| CAS No. | 2401-24-3 |
| Synonyms | 2-Chloro-5-methoxyaniline; 6-chloro-meta-anisidine; 3-Amino-4-chloroanisole |
| InChI | InChI=1/C7H8ClNO.ClH/c1-10-5-2-3-6(8)7(9)4-5;/h2-4H,9H2,1H3;1H |
| Molecular Formula | C7H9Cl2NO |
| Molecular Weight | 194.0585 |
| Melting point | 207℃ |
| Boiling point | 255°C at 760 mmHg |
| Flash point | 108°C |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
2401-24-3 6-chloro-m-anisidine
service@apichina.com