| Product Name | 6-Chloro-3,4-methylenedioxy-benzaldehyde |
| CAS No. | 15952-61-1 |
| Synonyms | 6-Chloropiperonal; 6-Chloro-1,3-benzodioxole-5-carboxaldehyde~2-Chloro-4,5-(methylenedioxy)benzaldehyde; 6-chloro-1,3-benzodioxole-5-carbaldehyde |
| InChI | InChI=1/C8H5ClO3/c9-6-2-8-7(11-4-12-8)1-5(6)3-10/h1-3H,4H2 |
| Molecular Formula | C8H5ClO3 |
| Molecular Weight | 184.5765 |
| Density | 1.485g/cm3 |
| Boiling point | 295.5°C at 760 mmHg |
| Flash point | 138.1°C |
| Refractive index | 1.627 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
15952-61-1 6-chloro-3,4-methylenedioxy-benzaldehyde
service@apichina.com