| Product Name | 6-Chloro-2-fluoro-3-methylbenzoyl chloride |
| CAS No. | 261762-81-6 |
| Synonyms | 6-Chloro-2-fluoro-m-toluoyl chloride |
| InChI | InChI=1/C8H5Cl2FO/c1-4-2-3-5(9)6(7(4)11)8(10)12/h2-3H,1H3 |
| Molecular Formula | C8H5Cl2FO |
| Molecular Weight | 207.0291 |
| Density | 1.396g/cm3 |
| Boiling point | 247.1°C at 760 mmHg |
| Flash point | 103.2°C |
| Refractive index | 1.535 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
261762-81-6 6-chloro-2-fluoro-3-methylbenzoyl chloride
service@apichina.com