| Product Name | 6-Chloro-2,4-dimethixypyrimidine |
| CAS No. | 6320-15-6 |
| Synonyms | 6-Chloro-2,4-dimethoxypyrimidine; 4-chloro-2,6-dimethoxypyrimidine |
| InChI | InChI=1/C6H7ClN2O2/c1-10-5-3-4(7)8-6(9-5)11-2/h3H,1-2H3 |
| Molecular Formula | C6H7ClN2O2 |
| Molecular Weight | 174.585 |
| Density | 1.285g/cm3 |
| Melting point | 74-76℃ |
| Boiling point | 280.6°C at 760 mmHg |
| Flash point | 123.5°C |
| Refractive index | 1.51 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6320-15-6 6-chloro-2,4-dimethixypyrimidine
service@apichina.com