| Product Name | 6-Chloro-2,4-difluoroaniline |
| CAS No. | 36556-56-6 |
| Synonyms | 2-chloro-4,6-difluoroaniline |
| InChI | InChI=1/C6H4ClF2N/c7-6-4(9)1-3(8)2-5(6)10/h1-2H,10H2 |
| Molecular Formula | C6H4ClF2N |
| Molecular Weight | 163.5525 |
| Density | 1.459g/cm3 |
| Melting point | 28℃ |
| Boiling point | 208.3°C at 760 mmHg |
| Flash point | 92.2°C |
| Refractive index | 1.543 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
36556-56-6 6-chloro-2,4-difluoroaniline
service@apichina.com