| Product Name | 6-bromoquinoxaline |
| CAS No. | 50998-17-9 |
| Synonyms | Quinoxaline, 6-bromo- |
| InChI | InChI=1/C8H5BrN2/c9-6-1-2-7-8(5-6)11-4-3-10-7/h1-5H |
| Molecular Formula | C8H5BrN2 |
| Molecular Weight | 209.0427 |
| Density | 1.656g/cm3 |
| Melting point | 53℃ |
| Boiling point | 300.2°C at 760 mmHg |
| Flash point | 135.4°C |
| Refractive index | 1.685 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
50998-17-9 6-bromoquinoxaline
service@apichina.com